About trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane
trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane (PubChem CID 10718824) has the molecular formula C19H42OSi2Sn
and a molecular weight of 461.43 g/mol. Its IUPAC name is trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane.
Molecular Properties
| Compound Name | trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane |
| PubChem CID | 10718824 |
| Molecular Formula | C19H42OSi2Sn |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane |
| SMILES | CC(=C=C([Si](C)(C)C)[Sn](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H21OSi2.3C3H7.Sn/c1-10(11-13(5,6)7)8-9-12(2,3)4;3*1-3-2;/h1-7H3;3*3H,1-2H3; |
| InChIKey | JLNXKNWBZQIHEZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane?
The IUPAC name of trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane (CID 10718824) is trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane.
What is the SMILES notation for trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane?
The canonical SMILES for trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane is CC(=C=C([Si](C)(C)C)[Sn](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane?
The InChIKey is JLNXKNWBZQIHEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21OSi2.3C3H7.Sn/c1-10(11-13(5,6)7)8-9-12(2,3)4;3*1-3-2;/h1-7H3;3*3H,1-2H3;.
What are the key properties of trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane?
trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane has a molecular weight of 461.43 g/mol, XLogP of 7.36, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[3-trimethylsilyloxy-1-tri(propan-2-yl)stannylbuta-1,2-dienyl]silane is sourced from PubChem (CID 10718824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).