C13H14Cl2N2O3 — CID 107188914
2,3-dichloro-N-(cyclopropylmethyl)-N-ethyl-5-nitrobenzamide (PubChem CID 107188914) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is 2,3-dichloro-N-(cyclopropylmethyl)-N-ethyl-5-nitrobenzamide.
| Compound Name | 2,3-dichloro-N-(cyclopropylmethyl)-N-ethyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 107188914 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2,3-dichloro-N-(cyclopropylmethyl)-N-ethyl-5-nitrobenzamide |
| SMILES | CCN(CC1CC1)C(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3/c1-2-16(7-8-3-4-8)13(18)10-5-9(17(19)20)6-11(14)12(10)15/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | ZBTBIGSZJKSDFT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|