C22H32N4O5S — CID 10718960
N-tert-butyl-4-methyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]pentanamide (PubChem CID 10718960) has the molecular formula C22H32N4O5S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-tert-butyl-4-methyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]pentanamide.
| Compound Name | N-tert-butyl-4-methyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]pentanamide |
|---|---|
| PubChem CID | 10718960 |
| Molecular Formula | C22H32N4O5S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-tert-butyl-4-methyl-2-[(2S,5R)-2-[(4-nitrophenyl)methyl]-3,6-dioxo-5-(sulfanylmethyl)piperazin-1-yl]pentanamide |
| SMILES | CC(C)CC(C(=O)NC(C)(C)C)N1C(=O)[C@H](CS)NC(=O)[C@@H]1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H32N4O5S/c1-13(2)10-17(20(28)24-22(3,4)5)25-18(19(27)23-16(12-32)21(25)29)11-14-6-8-15(9-7-14)26(30)31/h6-9,13,16-18,32H,10-12H2,1-5H3,(H,23,27)(H,24,28)/t16-,17?,18-/m0/s1 |
| InChIKey | FXAWYNXKIRKVPJ-RGBJRUIASA-N |
| XLogP | 2.09 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|