C15H29N — CID 107189769
1-(2,2-dimethylcyclohexyl)-N-ethyl-3-methylbut-2-en-1-amine (PubChem CID 107189769) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclohexyl)-N-ethyl-3-methylbut-2-en-1-amine.
| Compound Name | 1-(2,2-dimethylcyclohexyl)-N-ethyl-3-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 107189769 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 1-(2,2-dimethylcyclohexyl)-N-ethyl-3-methylbut-2-en-1-amine |
| SMILES | CCNC(C=C(C)C)C1CCCCC1(C)C |
| InChI | InChI=1S/C15H29N/c1-6-16-14(11-12(2)3)13-9-7-8-10-15(13,4)5/h11,13-14,16H,6-10H2,1-5H3 |
| InChIKey | JFFKVEALCOASAK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|