About 7-ethyl-1,4-dimethylazulene
7-ethyl-1,4-dimethylazulene (PubChem CID 10719) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is 7-ethyl-1,4-dimethylazulene.
Molecular Properties
| Compound Name | 7-ethyl-1,4-dimethylazulene |
| PubChem CID | 10719 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 7-ethyl-1,4-dimethylazulene |
| SMILES | CCc1ccc(C)c2ccc(C)c-2c1 |
| InChI | InChI=1S/C14H16/c1-4-12-7-5-10(2)13-8-6-11(3)14(13)9-12/h5-9H,4H2,1-3H3 |
| InChIKey | GXGJIOMUZAGVEH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-ethyl-1,4-dimethylazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-1,4-dimethylazulene?
The IUPAC name of 7-ethyl-1,4-dimethylazulene (CID 10719) is 7-ethyl-1,4-dimethylazulene.
What is the SMILES notation for 7-ethyl-1,4-dimethylazulene?
The canonical SMILES for 7-ethyl-1,4-dimethylazulene is CCc1ccc(C)c2ccc(C)c-2c1.
What is the InChIKey of 7-ethyl-1,4-dimethylazulene?
The InChIKey is GXGJIOMUZAGVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16/c1-4-12-7-5-10(2)13-8-6-11(3)14(13)9-12/h5-9H,4H2,1-3H3.
What are the key properties of 7-ethyl-1,4-dimethylazulene?
7-ethyl-1,4-dimethylazulene has a molecular weight of 184.28 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-1,4-dimethylazulene is sourced from PubChem (CID 10719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).