C14H29N — CID 107190061
N,2-diethyl-1-(2-methylcyclopentyl)butan-1-amine (PubChem CID 107190061) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is N,2-diethyl-1-(2-methylcyclopentyl)butan-1-amine.
| Compound Name | N,2-diethyl-1-(2-methylcyclopentyl)butan-1-amine |
|---|---|
| PubChem CID | 107190061 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | N,2-diethyl-1-(2-methylcyclopentyl)butan-1-amine |
| SMILES | CCNC(C(CC)CC)C1CCCC1C |
| InChI | InChI=1S/C14H29N/c1-5-12(6-2)14(15-7-3)13-10-8-9-11(13)4/h11-15H,5-10H2,1-4H3 |
| InChIKey | DLJNWUREZQDTQM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |