C13H14ClN3O4 — CID 107190430
3-chloro-2-[2-cyanoethyl(propan-2-yl)amino]-5-nitrobenzoic acid (PubChem CID 107190430) has the molecular formula C13H14ClN3O4 and a molecular weight of 311.73 g/mol. Its IUPAC name is 3-chloro-2-[2-cyanoethyl(propan-2-yl)amino]-5-nitrobenzoic acid.
| Compound Name | 3-chloro-2-[2-cyanoethyl(propan-2-yl)amino]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 107190430 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-chloro-2-[2-cyanoethyl(propan-2-yl)amino]-5-nitrobenzoic acid |
| SMILES | CC(C)N(CCC#N)c1c(Cl)cc([N+](=O)[O-])cc1C(=O)O |
| InChI | InChI=1S/C13H14ClN3O4/c1-8(2)16(5-3-4-15)12-10(13(18)19)6-9(17(20)21)7-11(12)14/h6-8H,3,5H2,1-2H3,(H,18,19) |
| InChIKey | BCBWRABBXJOHJS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|