C25H24Cl2N4O — CID 10719054
1-[4-(7,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-2-yl)piperazin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 10719054) has the molecular formula C25H24Cl2N4O and a molecular weight of 467.40 g/mol. Its IUPAC name is 1-[4-(7,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-2-yl)piperazin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[4-(7,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-2-yl)piperazin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 10719054 |
| Molecular Formula | C25H24Cl2N4O |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-[4-(7,13-dichloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaen-2-yl)piperazin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1CCN(C2c3ccc(Cl)cc3CCc3c(Cl)ccnc32)CC1 |
| InChI | InChI=1S/C25H24Cl2N4O/c26-19-4-6-20-18(15-19)3-5-21-22(27)7-9-29-24(21)25(20)31-12-10-30(11-13-31)23(32)14-17-2-1-8-28-16-17/h1-2,4,6-9,15-16,25H,3,5,10-14H2 |
| InChIKey | RYESZZWSLBGXMJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |