C26H50O5Si — CID 10719179
(2R)-3-[(2S,3R,5S,6S,9R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(2-methylpropan-2-yl)oxy]propanal (PubChem CID 10719179) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is (2R)-3-[(2S,3R,5S,6S,9R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(2-methylpropan-2-yl)oxy]propanal.
| Compound Name | (2R)-3-[(2S,3R,5S,6S,9R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(2-methylpropan-2-yl)oxy]propanal |
|---|---|
| PubChem CID | 10719179 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (2R)-3-[(2S,3R,5S,6S,9R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decan-2-yl]-2-[(2-methylpropan-2-yl)oxy]propanal |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@]12O[C@@H](C[C@H](C=O)OC(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O2 |
| InChI | InChI=1S/C26H50O5Si/c1-18(2)21-13-12-19(3)15-26(21)30-22(14-20(16-27)29-24(4,5)6)23(31-26)17-28-32(10,11)25(7,8)9/h16,18-23H,12-15,17H2,1-11H3/t19-,20-,21+,22+,23-,26+/m1/s1 |
| InChIKey | LOQVQOPWJQMXAU-KQGNZNRPSA-N |
| XLogP | 6.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|