C20H27N3O2S — CID 1071921
2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N,N-diethylacetamide (PubChem CID 1071921) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 1071921 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nc2ccccc2c(=O)n1C1CCCCC1 |
| InChI | InChI=1S/C20H27N3O2S/c1-3-22(4-2)18(24)14-26-20-21-17-13-9-8-12-16(17)19(25)23(20)15-10-6-5-7-11-15/h8-9,12-13,15H,3-7,10-11,14H2,1-2H3 |
| InChIKey | XTCPRKCBNFWQSM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |