C18H30N2 — CID 107193532
[1-(2,2-dimethylcyclopentyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine (PubChem CID 107193532) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is [1-(2,2-dimethylcyclopentyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine.
| Compound Name | [1-(2,2-dimethylcyclopentyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107193532 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | [1-(2,2-dimethylcyclopentyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine |
| SMILES | Cc1cc(C)c(CC(NN)C2CCCC2(C)C)c(C)c1 |
| InChI | InChI=1S/C18H30N2/c1-12-9-13(2)15(14(3)10-12)11-17(20-19)16-7-6-8-18(16,4)5/h9-10,16-17,20H,6-8,11,19H2,1-5H3 |
| InChIKey | LXOZLEMUFKOSOA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|