C9H9ClF3N3O — CID 107193570
5-amino-3-chloro-2-(2,2,2-trifluoroethylamino)benzamide (PubChem CID 107193570) has the molecular formula C9H9ClF3N3O and a molecular weight of 267.64 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,2,2-trifluoroethylamino)benzamide.
| Compound Name | 5-amino-3-chloro-2-(2,2,2-trifluoroethylamino)benzamide |
|---|---|
| PubChem CID | 107193570 |
| Molecular Formula | C9H9ClF3N3O |
| Molecular Weight | 267.64 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 5-amino-3-chloro-2-(2,2,2-trifluoroethylamino)benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1NCC(F)(F)F |
| InChI | InChI=1S/C9H9ClF3N3O/c10-6-2-4(14)1-5(8(15)17)7(6)16-3-9(11,12)13/h1-2,16H,3,14H2,(H2,15,17) |
| InChIKey | OBOHNYIEWGWHHV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|