C15H14ClFN2O2 — CID 107193614
5-amino-3-chloro-2-[(3-fluorophenyl)methyl-methylamino]benzoic acid (PubChem CID 107193614) has the molecular formula C15H14ClFN2O2 and a molecular weight of 308.74 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[(3-fluorophenyl)methyl-methylamino]benzoic acid.
| Compound Name | 5-amino-3-chloro-2-[(3-fluorophenyl)methyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 107193614 |
| Molecular Formula | C15H14ClFN2O2 |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 5-amino-3-chloro-2-[(3-fluorophenyl)methyl-methylamino]benzoic acid |
| SMILES | CN(Cc1cccc(F)c1)c1c(Cl)cc(N)cc1C(=O)O |
| InChI | InChI=1S/C15H14ClFN2O2/c1-19(8-9-3-2-4-10(17)5-9)14-12(15(20)21)6-11(18)7-13(14)16/h2-7H,8,18H2,1H3,(H,20,21) |
| InChIKey | WWZRPQCULJHRDM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|