C28H48O4Si — CID 10719389
methyl 5-[(3aS,6R,6aS)-6-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl]pentanoate (PubChem CID 10719389) has the molecular formula C28H48O4Si and a molecular weight of 476.77 g/mol. Its IUPAC name is methyl 5-[(3aS,6R,6aS)-6-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aS,6R,6aS)-6-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 10719389 |
| Molecular Formula | C28H48O4Si |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | methyl 5-[(3aS,6R,6aS)-6-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl]pentanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1C(=O)C[C@@H]2C=C(CCCCC(=O)OC)C[C@@H]21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H48O4Si/c1-8-9-10-14-23(32-33(6,7)28(2,3)4)16-17-24-25-19-21(18-22(25)20-26(24)29)13-11-12-15-27(30)31-5/h16-18,22-25H,8-15,19-20H2,1-7H3/b17-16+/t22-,23-,24+,25-/m0/s1 |
| InChIKey | OVQNUUFLDFNWFU-JUAYPPNXSA-N |
| XLogP | 7.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|