C23H48O6Si2 — CID 10719391
2-trimethylsilylethyl (E,2S,3R)-3-hydroxy-7-(2-methoxyethoxymethoxy)-7-methyl-2-[(1R)-1-trimethylsilylethyl]oct-4-enoate (PubChem CID 10719391) has the molecular formula C23H48O6Si2 and a molecular weight of 476.80 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,2S,3R)-3-hydroxy-7-(2-methoxyethoxymethoxy)-7-methyl-2-[(1R)-1-trimethylsilylethyl]oct-4-enoate.
| Compound Name | 2-trimethylsilylethyl (E,2S,3R)-3-hydroxy-7-(2-methoxyethoxymethoxy)-7-methyl-2-[(1R)-1-trimethylsilylethyl]oct-4-enoate |
|---|---|
| PubChem CID | 10719391 |
| Molecular Formula | C23H48O6Si2 |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | 2-trimethylsilylethyl (E,2S,3R)-3-hydroxy-7-(2-methoxyethoxymethoxy)-7-methyl-2-[(1R)-1-trimethylsilylethyl]oct-4-enoate |
| SMILES | COCCOCOC(C)(C)C/C=C/[C@@H](O)[C@@H](C(=O)OCC[Si](C)(C)C)[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C23H48O6Si2/c1-19(31(8,9)10)21(22(25)28-16-17-30(5,6)7)20(24)12-11-13-23(2,3)29-18-27-15-14-26-4/h11-12,19-21,24H,13-18H2,1-10H3/b12-11+/t19-,20-,21+/m1/s1 |
| InChIKey | DREVESCNVPKMJY-HVGCMSPYSA-N |
| XLogP | 4.94 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|