C17H26N2O — CID 107194689
[2-(3,4-dihydro-2H-chromen-4-yl)-1-(2-methylcyclopentyl)ethyl]hydrazine (PubChem CID 107194689) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-chromen-4-yl)-1-(2-methylcyclopentyl)ethyl]hydrazine.
| Compound Name | [2-(3,4-dihydro-2H-chromen-4-yl)-1-(2-methylcyclopentyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107194689 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | [2-(3,4-dihydro-2H-chromen-4-yl)-1-(2-methylcyclopentyl)ethyl]hydrazine |
| SMILES | CC1CCCC1C(CC1CCOc2ccccc21)NN |
| InChI | InChI=1S/C17H26N2O/c1-12-5-4-7-14(12)16(19-18)11-13-9-10-20-17-8-3-2-6-15(13)17/h2-3,6,8,12-14,16,19H,4-5,7,9-11,18H2,1H3 |
| InChIKey | BEOAIHLLMLSYNG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|