C13H20ClN3O — CID 107194825
5-amino-3-chloro-2-(3-methylpentan-2-ylamino)benzamide (PubChem CID 107194825) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(3-methylpentan-2-ylamino)benzamide.
| Compound Name | 5-amino-3-chloro-2-(3-methylpentan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 107194825 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 5-amino-3-chloro-2-(3-methylpentan-2-ylamino)benzamide |
| SMILES | CCC(C)C(C)Nc1c(Cl)cc(N)cc1C(N)=O |
| InChI | InChI=1S/C13H20ClN3O/c1-4-7(2)8(3)17-12-10(13(16)18)5-9(15)6-11(12)14/h5-8,17H,4,15H2,1-3H3,(H2,16,18) |
| InChIKey | BDZOAHQOJOTLNS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|