C13H9Br2ClN2O2 — CID 107194856
5-amino-3-chloro-2-(2,5-dibromoanilino)benzoic acid (PubChem CID 107194856) has the molecular formula C13H9Br2ClN2O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,5-dibromoanilino)benzoic acid.
| Compound Name | 5-amino-3-chloro-2-(2,5-dibromoanilino)benzoic acid |
|---|---|
| PubChem CID | 107194856 |
| Molecular Formula | C13H9Br2ClN2O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 417.87 |
| IUPAC Name | 5-amino-3-chloro-2-(2,5-dibromoanilino)benzoic acid |
| SMILES | Nc1cc(Cl)c(Nc2cc(Br)ccc2Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H9Br2ClN2O2/c14-6-1-2-9(15)11(3-6)18-12-8(13(19)20)4-7(17)5-10(12)16/h1-5,18H,17H2,(H,19,20) |
| InChIKey | UUXJLNWHYZMTGY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|