C17H23ClN2O — CID 107194873
[(7-chloro-1-benzofuran-2-yl)-(2,2-dimethylcyclohexyl)methyl]hydrazine (PubChem CID 107194873) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is [(7-chloro-1-benzofuran-2-yl)-(2,2-dimethylcyclohexyl)methyl]hydrazine.
| Compound Name | [(7-chloro-1-benzofuran-2-yl)-(2,2-dimethylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107194873 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [(7-chloro-1-benzofuran-2-yl)-(2,2-dimethylcyclohexyl)methyl]hydrazine |
| SMILES | CC1(C)CCCCC1C(NN)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C17H23ClN2O/c1-17(2)9-4-3-7-12(17)15(20-19)14-10-11-6-5-8-13(18)16(11)21-14/h5-6,8,10,12,15,20H,3-4,7,9,19H2,1-2H3 |
| InChIKey | PBCPXPZJMWXWGF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|