C12H13ClF3N3O — CID 107195385
5-amino-3-chloro-2-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzamide (PubChem CID 107195385) has the molecular formula C12H13ClF3N3O and a molecular weight of 307.70 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzamide.
| Compound Name | 5-amino-3-chloro-2-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzamide |
|---|---|
| PubChem CID | 107195385 |
| Molecular Formula | C12H13ClF3N3O |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-amino-3-chloro-2-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H13ClF3N3O/c13-9-4-6(17)3-8(11(18)20)10(9)19(7-1-2-7)5-12(14,15)16/h3-4,7H,1-2,5,17H2,(H2,18,20) |
| InChIKey | AJCBAHCTVPHYIT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|