C12H15ClF3N3O — CID 107195388
5-amino-3-chloro-2-[propyl(2,2,2-trifluoroethyl)amino]benzamide (PubChem CID 107195388) has the molecular formula C12H15ClF3N3O and a molecular weight of 309.72 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[propyl(2,2,2-trifluoroethyl)amino]benzamide.
| Compound Name | 5-amino-3-chloro-2-[propyl(2,2,2-trifluoroethyl)amino]benzamide |
|---|---|
| PubChem CID | 107195388 |
| Molecular Formula | C12H15ClF3N3O |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 5-amino-3-chloro-2-[propyl(2,2,2-trifluoroethyl)amino]benzamide |
| SMILES | CCCN(CC(F)(F)F)c1c(Cl)cc(N)cc1C(N)=O |
| InChI | InChI=1S/C12H15ClF3N3O/c1-2-3-19(6-12(14,15)16)10-8(11(18)20)4-7(17)5-9(10)13/h4-5H,2-3,6,17H2,1H3,(H2,18,20) |
| InChIKey | KKSWWJWXSLUZJT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|