C22H25N7O6 — CID 10719626
N-[(2S,3R,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-4-nitrobenzamide (PubChem CID 10719626) has the molecular formula C22H25N7O6 and a molecular weight of 483.49 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-4-nitrobenzamide.
| Compound Name | N-[(2S,3R,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 10719626 |
| Molecular Formula | C22H25N7O6 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | N-[(2S,3R,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-4-nitrobenzamide |
| SMILES | O=C(N[C@@H]1[C@@H](O)[C@H](n2cnc3c(NC4CCCC4)ncnc32)O[C@@H]1CO)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H25N7O6/c30-9-15-16(27-21(32)12-5-7-14(8-6-12)29(33)34)18(31)22(35-15)28-11-25-17-19(23-10-24-20(17)28)26-13-3-1-2-4-13/h5-8,10-11,13,15-16,18,22,30-31H,1-4,9H2,(H,27,32)(H,23,24,26)/t15-,16+,18-,22-/m1/s1 |
| InChIKey | HVDPKVMGEBDGBC-UNMKOGDSSA-N |
| XLogP | 1.14 |
| TPSA | 177.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|