C9H10ClF2N3O — CID 107196439
5-amino-3-chloro-2-(2,2-difluoroethylamino)benzamide (PubChem CID 107196439) has the molecular formula C9H10ClF2N3O and a molecular weight of 249.65 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,2-difluoroethylamino)benzamide.
| Compound Name | 5-amino-3-chloro-2-(2,2-difluoroethylamino)benzamide |
|---|---|
| PubChem CID | 107196439 |
| Molecular Formula | C9H10ClF2N3O |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 5-amino-3-chloro-2-(2,2-difluoroethylamino)benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1NCC(F)F |
| InChI | InChI=1S/C9H10ClF2N3O/c10-6-2-4(13)1-5(9(14)16)8(6)15-3-7(11)12/h1-2,7,15H,3,13H2,(H2,14,16) |
| InChIKey | HZTIRNJIJHWXKV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|