C12H15ClF3N3O — CID 107196445
5-amino-3-chloro-2-(5,5,5-trifluoropentylamino)benzamide (PubChem CID 107196445) has the molecular formula C12H15ClF3N3O and a molecular weight of 309.72 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(5,5,5-trifluoropentylamino)benzamide.
| Compound Name | 5-amino-3-chloro-2-(5,5,5-trifluoropentylamino)benzamide |
|---|---|
| PubChem CID | 107196445 |
| Molecular Formula | C12H15ClF3N3O |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 5-amino-3-chloro-2-(5,5,5-trifluoropentylamino)benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1NCCCCC(F)(F)F |
| InChI | InChI=1S/C12H15ClF3N3O/c13-9-6-7(17)5-8(11(18)20)10(9)19-4-2-1-3-12(14,15)16/h5-6,19H,1-4,17H2,(H2,18,20) |
| InChIKey | CHTOOQFKHWACDZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|