C10H12ClF2N3O — CID 107196799
5-amino-3-chloro-2-[2,2-difluoroethyl(methyl)amino]benzamide (PubChem CID 107196799) has the molecular formula C10H12ClF2N3O and a molecular weight of 263.68 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[2,2-difluoroethyl(methyl)amino]benzamide.
| Compound Name | 5-amino-3-chloro-2-[2,2-difluoroethyl(methyl)amino]benzamide |
|---|---|
| PubChem CID | 107196799 |
| Molecular Formula | C10H12ClF2N3O |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-amino-3-chloro-2-[2,2-difluoroethyl(methyl)amino]benzamide |
| SMILES | CN(CC(F)F)c1c(Cl)cc(N)cc1C(N)=O |
| InChI | InChI=1S/C10H12ClF2N3O/c1-16(4-8(12)13)9-6(10(15)17)2-5(14)3-7(9)11/h2-3,8H,4,14H2,1H3,(H2,15,17) |
| InChIKey | XFQFVWMESMZHQA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|