C13H14ClN3O2 — CID 107197117
5-amino-3-chloro-2-(2-propylimidazol-1-yl)benzoic acid (PubChem CID 107197117) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2-propylimidazol-1-yl)benzoic acid.
| Compound Name | 5-amino-3-chloro-2-(2-propylimidazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 107197117 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-amino-3-chloro-2-(2-propylimidazol-1-yl)benzoic acid |
| SMILES | CCCc1nccn1-c1c(Cl)cc(N)cc1C(=O)O |
| InChI | InChI=1S/C13H14ClN3O2/c1-2-3-11-16-4-5-17(11)12-9(13(18)19)6-8(15)7-10(12)14/h4-7H,2-3,15H2,1H3,(H,18,19) |
| InChIKey | CDYKDJRVCXOHAH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|