C12H10ClN3O2S — CID 107198631
5-amino-3-chloro-2-(5-methylpyrimidin-2-yl)sulfanylbenzoic acid (PubChem CID 107198631) has the molecular formula C12H10ClN3O2S and a molecular weight of 295.75 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(5-methylpyrimidin-2-yl)sulfanylbenzoic acid.
| Compound Name | 5-amino-3-chloro-2-(5-methylpyrimidin-2-yl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 107198631 |
| Molecular Formula | C12H10ClN3O2S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 5-amino-3-chloro-2-(5-methylpyrimidin-2-yl)sulfanylbenzoic acid |
| SMILES | Cc1cnc(Sc2c(Cl)cc(N)cc2C(=O)O)nc1 |
| InChI | InChI=1S/C12H10ClN3O2S/c1-6-4-15-12(16-5-6)19-10-8(11(17)18)2-7(14)3-9(10)13/h2-5H,14H2,1H3,(H,17,18) |
| InChIKey | UGMTUTQTTNXGRP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|