C32H42O4 — CID 10719875
ethyl 4-[2-[(3R,5R,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethynyl]benzoate (PubChem CID 10719875) has the molecular formula C32H42O4 and a molecular weight of 490.68 g/mol. Its IUPAC name is ethyl 4-[2-[(3R,5R,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[(3R,5R,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 10719875 |
| Molecular Formula | C32H42O4 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | ethyl 4-[2-[(3R,5R,8R,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#C[C@@]2(O)CC[C@@]3(C)[C@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](C(C)=O)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C32H42O4/c1-5-36-29(34)23-8-6-22(7-9-23)14-17-32(35)19-18-30(3)24(20-32)10-11-25-27-13-12-26(21(2)33)31(27,4)16-15-28(25)30/h6-9,24-28,35H,5,10-13,15-16,18-20H2,1-4H3/t24-,25+,26-,27+,28+,30+,31-,32-/m1/s1 |
| InChIKey | MWTJRIFJTFLPGT-LEWFILGVSA-N |
| XLogP | 6.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|