C27H42O6Si — CID 10719877
(2R,4S,4aR,6R,8aR)-6-but-3-enyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-3-one (PubChem CID 10719877) has the molecular formula C27H42O6Si and a molecular weight of 490.71 g/mol. Its IUPAC name is (2R,4S,4aR,6R,8aR)-6-but-3-enyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-3-one.
| Compound Name | (2R,4S,4aR,6R,8aR)-6-but-3-enyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-3-one |
|---|---|
| PubChem CID | 10719877 |
| Molecular Formula | C27H42O6Si |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | (2R,4S,4aR,6R,8aR)-6-but-3-enyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxy-4-phenylmethoxy-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-b]pyran-3-one |
| SMILES | C=CCC[C@]1(OC)CC[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)C(=O)[C@@H](OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C27H42O6Si/c1-8-9-16-27(29-5)17-15-21-24(33-27)25(30-18-20-13-11-10-12-14-20)23(28)22(32-21)19-31-34(6,7)26(2,3)4/h8,10-14,21-22,24-25H,1,9,15-19H2,2-7H3/t21-,22-,24-,25-,27-/m1/s1 |
| InChIKey | CHEXSBFKPMQRJP-AQYHYTTBSA-N |
| XLogP | 5.42 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|