C9H17F3N2O2 — CID 107198916
1-(5-hydroxypentyl)-1-methyl-3-(2,2,2-trifluoroethyl)urea (PubChem CID 107198916) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-(5-hydroxypentyl)-1-methyl-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(5-hydroxypentyl)-1-methyl-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 107198916 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(5-hydroxypentyl)-1-methyl-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CN(CCCCCO)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-14(5-3-2-4-6-15)8(16)13-7-9(10,11)12/h15H,2-7H2,1H3,(H,13,16) |
| InChIKey | BZMGEJHAEMAYCX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|