C15H24N2O3 — CID 107199354
2-amino-N-(5-hydroxypentyl)-3-(4-hydroxyphenyl)-N-methylpropanamide (PubChem CID 107199354) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-amino-N-(5-hydroxypentyl)-3-(4-hydroxyphenyl)-N-methylpropanamide.
| Compound Name | 2-amino-N-(5-hydroxypentyl)-3-(4-hydroxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 107199354 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-amino-N-(5-hydroxypentyl)-3-(4-hydroxyphenyl)-N-methylpropanamide |
| SMILES | CN(CCCCCO)C(=O)C(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H24N2O3/c1-17(9-3-2-4-10-18)15(20)14(16)11-12-5-7-13(19)8-6-12/h5-8,14,18-19H,2-4,9-11,16H2,1H3 |
| InChIKey | IBYPYIDPGYEOEO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|