C16H26N2O2S — CID 107199816
3-[3-[5-hydroxypentyl(methyl)amino]propoxy]benzenecarbothioamide (PubChem CID 107199816) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 3-[3-[5-hydroxypentyl(methyl)amino]propoxy]benzenecarbothioamide.
| Compound Name | 3-[3-[5-hydroxypentyl(methyl)amino]propoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 107199816 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 3-[3-[5-hydroxypentyl(methyl)amino]propoxy]benzenecarbothioamide |
| SMILES | CN(CCCCCO)CCCOc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C16H26N2O2S/c1-18(9-3-2-4-11-19)10-6-12-20-15-8-5-7-14(13-15)16(17)21/h5,7-8,13,19H,2-4,6,9-12H2,1H3,(H2,17,21) |
| InChIKey | GPHDHYDTBOBMRY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|