C30H29N3O4 — CID 10720045
(E)-7-[4-[4-(2-phenylethylcarbamoyl)-1,3-oxazol-2-yl]phenyl]-7-pyridin-3-ylhept-6-enoic acid (PubChem CID 10720045) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is (E)-7-[4-[4-(2-phenylethylcarbamoyl)-1,3-oxazol-2-yl]phenyl]-7-pyridin-3-ylhept-6-enoic acid.
| Compound Name | (E)-7-[4-[4-(2-phenylethylcarbamoyl)-1,3-oxazol-2-yl]phenyl]-7-pyridin-3-ylhept-6-enoic acid |
|---|---|
| PubChem CID | 10720045 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | (E)-7-[4-[4-(2-phenylethylcarbamoyl)-1,3-oxazol-2-yl]phenyl]-7-pyridin-3-ylhept-6-enoic acid |
| SMILES | O=C(O)CCCC/C=C(\c1ccc(-c2nc(C(=O)NCCc3ccccc3)co2)cc1)c1cccnc1 |
| InChI | InChI=1S/C30H29N3O4/c34-28(35)12-6-2-5-11-26(25-10-7-18-31-20-25)23-13-15-24(16-14-23)30-33-27(21-37-30)29(36)32-19-17-22-8-3-1-4-9-22/h1,3-4,7-11,13-16,18,20-21H,2,5-6,12,17,19H2,(H,32,36)(H,34,35)/b26-11+ |
| InChIKey | DOIVAJMCRLNJKI-KBKYJPHKSA-N |
| XLogP | 5.79 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|