C32H37N3O2 — CID 10720054
N-benzyl-4-[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]-N-methylbutan-1-amine (PubChem CID 10720054) has the molecular formula C32H37N3O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-benzyl-4-[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]-N-methylbutan-1-amine.
| Compound Name | N-benzyl-4-[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 10720054 |
| Molecular Formula | C32H37N3O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-benzyl-4-[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]-N-methylbutan-1-amine |
| SMILES | CN(CCCCC1(C)COC(c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)OC1)Cc1ccccc1 |
| InChI | InChI=1S/C32H37N3O2/c1-32(20-12-13-21-35(2)22-25-14-6-3-7-15-25)23-36-31(37-24-32)30-33-28(26-16-8-4-9-17-26)29(34-30)27-18-10-5-11-19-27/h3-11,14-19,31H,12-13,20-24H2,1-2H3,(H,33,34) |
| InChIKey | VQEXYVXDVNKUNJ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|