About 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate
3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate (PubChem CID 10720096) has the molecular formula C13H13I2N3O2
and a molecular weight of 497.07 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate.
Molecular Properties
| Compound Name | 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate |
| PubChem CID | 10720096 |
| Molecular Formula | C13H13I2N3O2 |
| Molecular Weight | 497.07 g/mol |
| Exact Mass | 496.91 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate |
| SMILES | Nc1c(I)cc(C(=O)OCCCc2cnc[nH]2)cc1I |
| InChI | InChI=1S/C13H13I2N3O2/c14-10-4-8(5-11(15)12(10)16)13(19)20-3-1-2-9-6-17-7-18-9/h4-7H,1-3,16H2,(H,17,18) |
| InChIKey | UNHCHXIPAZYWRZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.07 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate?
The IUPAC name of 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate (CID 10720096) is 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate.
What is the SMILES notation for 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate?
The canonical SMILES for 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate is Nc1c(I)cc(C(=O)OCCCc2cnc[nH]2)cc1I.
What is the InChIKey of 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate?
The InChIKey is UNHCHXIPAZYWRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13I2N3O2/c14-10-4-8(5-11(15)12(10)16)13(19)20-3-1-2-9-6-17-7-18-9/h4-7H,1-3,16H2,(H,17,18).
What are the key properties of 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate?
3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate has a molecular weight of 497.07 g/mol, XLogP of 2.99, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-5-yl)propyl 4-amino-3,5-diiodobenzoate is sourced from PubChem (CID 10720096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).