C14H28N2O4 — CID 107201739
3-[tert-butyl-[5-hydroxypentyl(methyl)carbamoyl]amino]propanoic acid (PubChem CID 107201739) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-[tert-butyl-[5-hydroxypentyl(methyl)carbamoyl]amino]propanoic acid.
| Compound Name | 3-[tert-butyl-[5-hydroxypentyl(methyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 107201739 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 3-[tert-butyl-[5-hydroxypentyl(methyl)carbamoyl]amino]propanoic acid |
| SMILES | CN(CCCCCO)C(=O)N(CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O4/c1-14(2,3)16(10-8-12(18)19)13(20)15(4)9-6-5-7-11-17/h17H,5-11H2,1-4H3,(H,18,19) |
| InChIKey | BEBRYBABWWZEEM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|