C16H22N2O3 — CID 107201961
N-(5-hydroxypentyl)-N-methyl-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 107201961) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N-methyl-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-N-methyl-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 107201961 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-(5-hydroxypentyl)-N-methyl-3-phenyl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CN(CCCCCO)C(=O)C1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C16H22N2O3/c1-18(10-6-3-7-11-19)16(20)15-12-14(17-21-15)13-8-4-2-5-9-13/h2,4-5,8-9,15,19H,3,6-7,10-12H2,1H3 |
| InChIKey | DKIQMOVRQKDHRF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|