C28H25ClN4O3 — CID 10720216
2-[2-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 10720216) has the molecular formula C28H25ClN4O3 and a molecular weight of 500.99 g/mol. Its IUPAC name is 2-[2-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10720216 |
| Molecular Formula | C28H25ClN4O3 |
| Molecular Weight | 500.99 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-[2-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)N1CCN(C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C28H25ClN4O3/c29-20-9-10-21-19(16-20)8-7-18-4-3-11-30-25(18)26(21)32-14-12-31(13-15-32)24(34)17-33-27(35)22-5-1-2-6-23(22)28(33)36/h1-6,9-11,16,26H,7-8,12-15,17H2 |
| InChIKey | ZLMHHZJUXGHHRE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.99 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|