C11H23NO4S — CID 107202909
N-(5-hydroxypentyl)-N,2-dimethyl-2-methylsulfonylpropanamide (PubChem CID 107202909) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N,2-dimethyl-2-methylsulfonylpropanamide.
| Compound Name | N-(5-hydroxypentyl)-N,2-dimethyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 107202909 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-(5-hydroxypentyl)-N,2-dimethyl-2-methylsulfonylpropanamide |
| SMILES | CN(CCCCCO)C(=O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H23NO4S/c1-11(2,17(4,15)16)10(14)12(3)8-6-5-7-9-13/h13H,5-9H2,1-4H3 |
| InChIKey | CEEBFOJUTNQHJM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|