C30H52O4Si — CID 10720312
methyl 5-[(3aS,6R,6aS)-6-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl]pentanoate (PubChem CID 10720312) has the molecular formula C30H52O4Si and a molecular weight of 504.83 g/mol. Its IUPAC name is methyl 5-[(3aS,6R,6aS)-6-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aS,6R,6aS)-6-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 10720312 |
| Molecular Formula | C30H52O4Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | methyl 5-[(3aS,6R,6aS)-6-[(E,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl]pentanoate |
| SMILES | CCCC[C@H](C)C[C@@H](/C=C/[C@H]1C(=O)C[C@@H]2C=C(CCCCC(=O)OC)C[C@@H]21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H52O4Si/c1-9-10-13-22(2)18-25(34-35(7,8)30(3,4)5)16-17-26-27-20-23(19-24(27)21-28(26)31)14-11-12-15-29(32)33-6/h16-17,19,22,24-27H,9-15,18,20-21H2,1-8H3/b17-16+/t22-,24-,25+,26+,27-/m0/s1 |
| InChIKey | LKCDCISBGMOTPE-XFYDDKFPSA-N |
| XLogP | 8.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|