C13H20N2O3 — CID 107203240
2-amino-3-[5-hydroxypentyl(methyl)amino]benzoic acid (PubChem CID 107203240) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-amino-3-[5-hydroxypentyl(methyl)amino]benzoic acid.
| Compound Name | 2-amino-3-[5-hydroxypentyl(methyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107203240 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-amino-3-[5-hydroxypentyl(methyl)amino]benzoic acid |
| SMILES | CN(CCCCCO)c1cccc(C(=O)O)c1N |
| InChI | InChI=1S/C13H20N2O3/c1-15(8-3-2-4-9-16)11-7-5-6-10(12(11)14)13(17)18/h5-7,16H,2-4,8-9,14H2,1H3,(H,17,18) |
| InChIKey | SGRAOEAXSWCCOX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|