About 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol
5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol (PubChem CID 107203331) has the molecular formula C11H16Br2N2O
and a molecular weight of 352.07 g/mol. Its IUPAC name is 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol.
Molecular Properties
| Compound Name | 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol |
| PubChem CID | 107203331 |
| Molecular Formula | C11H16Br2N2O |
| Molecular Weight | 352.07 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol |
| SMILES | CN(CCCCCO)c1ncc(Br)cc1Br |
| InChI | InChI=1S/C11H16Br2N2O/c1-15(5-3-2-4-6-16)11-10(13)7-9(12)8-14-11/h7-8,16H,2-6H2,1H3 |
| InChIKey | REESIHVNCGWRAK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.07 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol?
The IUPAC name of 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol (CID 107203331) is 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol.
What is the SMILES notation for 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol?
The canonical SMILES for 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol is CN(CCCCCO)c1ncc(Br)cc1Br.
What is the InChIKey of 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol?
The InChIKey is REESIHVNCGWRAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16Br2N2O/c1-15(5-3-2-4-6-16)11-10(13)7-9(12)8-14-11/h7-8,16H,2-6H2,1H3.
What are the key properties of 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol?
5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol has a molecular weight of 352.07 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dibromo-2-pyridinyl)-methylamino]pentan-1-ol is sourced from PubChem (CID 107203331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).