C9H17N3OS — CID 107203400
5-[methyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]pentan-1-ol (PubChem CID 107203400) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 5-[methyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]pentan-1-ol.
| Compound Name | 5-[methyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 107203400 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 5-[methyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]pentan-1-ol |
| SMILES | Cc1nnc(N(C)CCCCCO)s1 |
| InChI | InChI=1S/C9H17N3OS/c1-8-10-11-9(14-8)12(2)6-4-3-5-7-13/h13H,3-7H2,1-2H3 |
| InChIKey | QCDVKLAQRNUPLQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|