C12H21Br2N3 — CID 107204793
5-bromo-N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-N-methylpentan-1-amine (PubChem CID 107204793) has the molecular formula C12H21Br2N3 and a molecular weight of 367.13 g/mol. Its IUPAC name is 5-bromo-N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-N-methylpentan-1-amine.
| Compound Name | 5-bromo-N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 107204793 |
| Molecular Formula | C12H21Br2N3 |
| Molecular Weight | 367.13 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 5-bromo-N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-N-methylpentan-1-amine |
| SMILES | Cc1nn(C)c(CN(C)CCCCCBr)c1Br |
| InChI | InChI=1S/C12H21Br2N3/c1-10-12(14)11(17(3)15-10)9-16(2)8-6-4-5-7-13/h4-9H2,1-3H3 |
| InChIKey | LEPTUUSSJWQJOO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.13 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|