About N-(5-chloropentyl)-N,4-dimethylpentan-1-amine
N-(5-chloropentyl)-N,4-dimethylpentan-1-amine (PubChem CID 107204984) has the molecular formula C12H26ClN
and a molecular weight of 219.80 g/mol. Its IUPAC name is N-(5-chloropentyl)-N,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | N-(5-chloropentyl)-N,4-dimethylpentan-1-amine |
| PubChem CID | 107204984 |
| Molecular Formula | C12H26ClN |
| Molecular Weight | 219.80 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | N-(5-chloropentyl)-N,4-dimethylpentan-1-amine |
| SMILES | CC(C)CCCN(C)CCCCCCl |
| InChI | InChI=1S/C12H26ClN/c1-12(2)8-7-11-14(3)10-6-4-5-9-13/h12H,4-11H2,1-3H3 |
| InChIKey | QQZMZRDQXMSZPG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloropentyl)-N,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloropentyl)-N,4-dimethylpentan-1-amine?
The IUPAC name of N-(5-chloropentyl)-N,4-dimethylpentan-1-amine (CID 107204984) is N-(5-chloropentyl)-N,4-dimethylpentan-1-amine.
What is the SMILES notation for N-(5-chloropentyl)-N,4-dimethylpentan-1-amine?
The canonical SMILES for N-(5-chloropentyl)-N,4-dimethylpentan-1-amine is CC(C)CCCN(C)CCCCCCl.
What is the InChIKey of N-(5-chloropentyl)-N,4-dimethylpentan-1-amine?
The InChIKey is QQZMZRDQXMSZPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26ClN/c1-12(2)8-7-11-14(3)10-6-4-5-9-13/h12H,4-11H2,1-3H3.
What are the key properties of N-(5-chloropentyl)-N,4-dimethylpentan-1-amine?
N-(5-chloropentyl)-N,4-dimethylpentan-1-amine has a molecular weight of 219.80 g/mol, XLogP of 3.76, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloropentyl)-N,4-dimethylpentan-1-amine is sourced from PubChem (CID 107204984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).