About N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine
N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine (PubChem CID 107205351) has the molecular formula C13H17ClN4
and a molecular weight of 264.76 g/mol. Its IUPAC name is N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine.
Molecular Properties
| Compound Name | N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine |
| PubChem CID | 107205351 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine |
| SMILES | CN(CCCCCCl)c1nnc2ccccc2n1 |
| InChI | InChI=1S/C13H17ClN4/c1-18(10-6-2-5-9-14)13-15-11-7-3-4-8-12(11)16-17-13/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | WLGDUVSVMYSPKY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine?
The IUPAC name of N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine (CID 107205351) is N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine.
What is the SMILES notation for N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine?
The canonical SMILES for N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine is CN(CCCCCCl)c1nnc2ccccc2n1.
What is the InChIKey of N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine?
The InChIKey is WLGDUVSVMYSPKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN4/c1-18(10-6-2-5-9-14)13-15-11-7-3-4-8-12(11)16-17-13/h3-4,7-8H,2,5-6,9-10H2,1H3.
What are the key properties of N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine?
N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine has a molecular weight of 264.76 g/mol, XLogP of 2.87, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloropentyl)-N-methyl-1,2,4-benzotriazin-3-amine is sourced from PubChem (CID 107205351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).