C14H19BrClNO — CID 107205681
4-bromo-N-(5-chloropentyl)-N,3-dimethylbenzamide (PubChem CID 107205681) has the molecular formula C14H19BrClNO and a molecular weight of 332.67 g/mol. Its IUPAC name is 4-bromo-N-(5-chloropentyl)-N,3-dimethylbenzamide.
| Compound Name | 4-bromo-N-(5-chloropentyl)-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 107205681 |
| Molecular Formula | C14H19BrClNO |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 4-bromo-N-(5-chloropentyl)-N,3-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)N(C)CCCCCCl)ccc1Br |
| InChI | InChI=1S/C14H19BrClNO/c1-11-10-12(6-7-13(11)15)14(18)17(2)9-5-3-4-8-16/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | MQICQBQVDFTBDK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|