About N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide
N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide (PubChem CID 107206109) has the molecular formula C12H22BrNO
and a molecular weight of 276.22 g/mol. Its IUPAC name is N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide |
| PubChem CID | 107206109 |
| Molecular Formula | C12H22BrNO |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide |
| SMILES | CN(CCCCCBr)C(=O)C1CC1(C)C |
| InChI | InChI=1S/C12H22BrNO/c1-12(2)9-10(12)11(15)14(3)8-6-4-5-7-13/h10H,4-9H2,1-3H3 |
| InChIKey | LSGIJSJNFHGXSF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide?
The IUPAC name of N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide (CID 107206109) is N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide.
What is the SMILES notation for N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide?
The canonical SMILES for N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide is CN(CCCCCBr)C(=O)C1CC1(C)C.
What is the InChIKey of N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide?
The InChIKey is LSGIJSJNFHGXSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22BrNO/c1-12(2)9-10(12)11(15)14(3)8-6-4-5-7-13/h10H,4-9H2,1-3H3.
What are the key properties of N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide?
N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide has a molecular weight of 276.22 g/mol, XLogP of 3.06, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromopentyl)-N,2,2-trimethylcyclopropane-1-carboxamide is sourced from PubChem (CID 107206109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).