C26H54O4Si3 — CID 10720617
(E,4S,5R)-1,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]oct-6-en-2-yn-4-ol (PubChem CID 10720617) has the molecular formula C26H54O4Si3 and a molecular weight of 514.97 g/mol. Its IUPAC name is (E,4S,5R)-1,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]oct-6-en-2-yn-4-ol.
| Compound Name | (E,4S,5R)-1,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]oct-6-en-2-yn-4-ol |
|---|---|
| PubChem CID | 10720617 |
| Molecular Formula | C26H54O4Si3 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | (E,4S,5R)-1,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]oct-6-en-2-yn-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC#C[C@H](O)[C@@H](/C=C/CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O4Si3/c1-24(2,3)31(10,11)28-20-16-18-22(27)23(30-33(14,15)26(7,8)9)19-17-21-29-32(12,13)25(4,5)6/h17,19,22-23,27H,20-21H2,1-15H3/b19-17+/t22-,23+/m0/s1 |
| InChIKey | ORYOLOKUGMVAOB-ABZSSTOSSA-N |
| XLogP | 7.34 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|