C15H22BrNO3 — CID 107206269
N-(5-bromopentyl)-2,3-dimethoxy-N-methylbenzamide (PubChem CID 107206269) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is N-(5-bromopentyl)-2,3-dimethoxy-N-methylbenzamide.
| Compound Name | N-(5-bromopentyl)-2,3-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 107206269 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(5-bromopentyl)-2,3-dimethoxy-N-methylbenzamide |
| SMILES | COc1cccc(C(=O)N(C)CCCCCBr)c1OC |
| InChI | InChI=1S/C15H22BrNO3/c1-17(11-6-4-5-10-16)15(18)12-8-7-9-13(19-2)14(12)20-3/h7-9H,4-6,10-11H2,1-3H3 |
| InChIKey | ONCPYIMXMYAHNT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|